About 4-(2,3-dihydro-1,4-benzoxathiin-7-yloxy)-3-[(dimethylamino)methyl]benzamide
4-(2,3-dihydro-1,4-benzoxathiin-7-yloxy)-3-[(dimethylamino)methyl]benzamide (PubChem CID 10269037) has the molecular formula C18H20N2O3S
and a molecular weight of 344.44 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzoxathiin-7-yloxy)-3-[(dimethylamino)methyl]benzamide.
Molecular Properties
| Compound Name | 4-(2,3-dihydro-1,4-benzoxathiin-7-yloxy)-3-[(dimethylamino)methyl]benzamide |
| PubChem CID | 10269037 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzoxathiin-7-yloxy)-3-[(dimethylamino)methyl]benzamide |
| SMILES | CN(C)Cc1cc(C(N)=O)ccc1Oc1ccc2c(c1)OCCS2 |
| InChI | InChI=1S/C18H20N2O3S/c1-20(2)11-13-9-12(18(19)21)3-5-15(13)23-14-4-6-17-16(10-14)22-7-8-24-17/h3-6,9-10H,7-8,11H2,1-2H3,(H2,19,21) |
| InChIKey | IRWJTTNPJDLUOM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2,3-dihydro-1,4-benzoxathiin-7-yloxy)-3-[(dimethylamino)methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dihydro-1,4-benzoxathiin-7-yloxy)-3-[(dimethylamino)methyl]benzamide?
The IUPAC name of 4-(2,3-dihydro-1,4-benzoxathiin-7-yloxy)-3-[(dimethylamino)methyl]benzamide (CID 10269037) is 4-(2,3-dihydro-1,4-benzoxathiin-7-yloxy)-3-[(dimethylamino)methyl]benzamide.
What is the SMILES notation for 4-(2,3-dihydro-1,4-benzoxathiin-7-yloxy)-3-[(dimethylamino)methyl]benzamide?
The canonical SMILES for 4-(2,3-dihydro-1,4-benzoxathiin-7-yloxy)-3-[(dimethylamino)methyl]benzamide is CN(C)Cc1cc(C(N)=O)ccc1Oc1ccc2c(c1)OCCS2.
What is the InChIKey of 4-(2,3-dihydro-1,4-benzoxathiin-7-yloxy)-3-[(dimethylamino)methyl]benzamide?
The InChIKey is IRWJTTNPJDLUOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O3S/c1-20(2)11-13-9-12(18(19)21)3-5-15(13)23-14-4-6-17-16(10-14)22-7-8-24-17/h3-6,9-10H,7-8,11H2,1-2H3,(H2,19,21).
What are the key properties of 4-(2,3-dihydro-1,4-benzoxathiin-7-yloxy)-3-[(dimethylamino)methyl]benzamide?
4-(2,3-dihydro-1,4-benzoxathiin-7-yloxy)-3-[(dimethylamino)methyl]benzamide has a molecular weight of 344.44 g/mol, XLogP of 3.12, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydro-1,4-benzoxathiin-7-yloxy)-3-[(dimethylamino)methyl]benzamide is sourced from PubChem (CID 10269037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).