About N-(2,2,2-trifluoroethoxy)-1H-pyrazole-5-sulfonamide
N-(2,2,2-trifluoroethoxy)-1H-pyrazole-5-sulfonamide (PubChem CID 102690999) has the molecular formula C5H6F3N3O3S
and a molecular weight of 245.18 g/mol. Its IUPAC name is N-(2,2,2-trifluoroethoxy)-1H-pyrazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-(2,2,2-trifluoroethoxy)-1H-pyrazole-5-sulfonamide |
| PubChem CID | 102690999 |
| Molecular Formula | C5H6F3N3O3S |
| Molecular Weight | 245.18 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | N-(2,2,2-trifluoroethoxy)-1H-pyrazole-5-sulfonamide |
| SMILES | O=S(=O)(NOCC(F)(F)F)c1ccn[nH]1 |
| InChI | InChI=1S/C5H6F3N3O3S/c6-5(7,8)3-14-11-15(12,13)4-1-2-9-10-4/h1-2,11H,3H2,(H,9,10) |
| InChIKey | RGYFGIOCBOVVKM-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.18 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2,2-trifluoroethoxy)-1H-pyrazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2,2-trifluoroethoxy)-1H-pyrazole-5-sulfonamide?
The IUPAC name of N-(2,2,2-trifluoroethoxy)-1H-pyrazole-5-sulfonamide (CID 102690999) is N-(2,2,2-trifluoroethoxy)-1H-pyrazole-5-sulfonamide.
What is the SMILES notation for N-(2,2,2-trifluoroethoxy)-1H-pyrazole-5-sulfonamide?
The canonical SMILES for N-(2,2,2-trifluoroethoxy)-1H-pyrazole-5-sulfonamide is O=S(=O)(NOCC(F)(F)F)c1ccn[nH]1.
What is the InChIKey of N-(2,2,2-trifluoroethoxy)-1H-pyrazole-5-sulfonamide?
The InChIKey is RGYFGIOCBOVVKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6F3N3O3S/c6-5(7,8)3-14-11-15(12,13)4-1-2-9-10-4/h1-2,11H,3H2,(H,9,10).
What are the key properties of N-(2,2,2-trifluoroethoxy)-1H-pyrazole-5-sulfonamide?
N-(2,2,2-trifluoroethoxy)-1H-pyrazole-5-sulfonamide has a molecular weight of 245.18 g/mol, XLogP of 0.18, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2,2-trifluoroethoxy)-1H-pyrazole-5-sulfonamide is sourced from PubChem (CID 102690999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).