C10H16F3N3O3S — CID 102692166
N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102692166) has the molecular formula C10H16F3N3O3S and a molecular weight of 315.32 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102692166 |
| Molecular Formula | C10H16F3N3O3S |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCOCCCN(CC(F)(F)F)S(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C10H16F3N3O3S/c1-2-19-7-3-6-16(8-10(11,12)13)20(17,18)9-4-5-14-15-9/h4-5H,2-3,6-8H2,1H3,(H,14,15) |
| InChIKey | HWZHEPWWSMWKAJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|