About N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide
N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102692310) has the molecular formula C7H10F3N3O3S
and a molecular weight of 273.24 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide |
| PubChem CID | 102692310 |
| Molecular Formula | C7H10F3N3O3S |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide |
| SMILES | O=S(=O)(c1ccn[nH]1)N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C7H10F3N3O3S/c8-7(9,10)5-13(3-4-14)17(15,16)6-1-2-11-12-6/h1-2,14H,3-5H2,(H,11,12) |
| InChIKey | WNDFJFADPNYLGG-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide?
The IUPAC name of N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide (CID 102692310) is N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide.
What is the SMILES notation for N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide?
The canonical SMILES for N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide is O=S(=O)(c1ccn[nH]1)N(CCO)CC(F)(F)F.
What is the InChIKey of N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide?
The InChIKey is WNDFJFADPNYLGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F3N3O3S/c8-7(9,10)5-13(3-4-14)17(15,16)6-1-2-11-12-6/h1-2,14H,3-5H2,(H,11,12).
What are the key properties of N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide?
N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide has a molecular weight of 273.24 g/mol, XLogP of -0.05, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxyethyl)-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide is sourced from PubChem (CID 102692310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).