C6H8N6O2S — CID 102692319
N-(1H-1,2,4-triazol-5-ylmethyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102692319) has the molecular formula C6H8N6O2S and a molecular weight of 228.24 g/mol. Its IUPAC name is N-(1H-1,2,4-triazol-5-ylmethyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(1H-1,2,4-triazol-5-ylmethyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102692319 |
| Molecular Formula | C6H8N6O2S |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | N-(1H-1,2,4-triazol-5-ylmethyl)-1H-pyrazole-5-sulfonamide |
| SMILES | O=S(=O)(NCc1ncn[nH]1)c1ccn[nH]1 |
| InChI | InChI=1S/C6H8N6O2S/c13-15(14,6-1-2-8-12-6)10-3-5-7-4-9-11-5/h1-2,4,10H,3H2,(H,8,12)(H,7,9,11) |
| InChIKey | DSYORNXTMOLONQ-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |