About N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-pyrazole-5-sulfonamide
N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-pyrazole-5-sulfonamide (PubChem CID 102692323) has the molecular formula C7H10N6O2S
and a molecular weight of 242.26 g/mol. Its IUPAC name is N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-pyrazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-pyrazole-5-sulfonamide |
| PubChem CID | 102692323 |
| Molecular Formula | C7H10N6O2S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-pyrazole-5-sulfonamide |
| SMILES | Cn1cnnc1CNS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C7H10N6O2S/c1-13-5-9-11-6(13)4-10-16(14,15)7-2-3-8-12-7/h2-3,5,10H,4H2,1H3,(H,8,12) |
| InChIKey | PYONKCLTCPNAHF-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-pyrazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-pyrazole-5-sulfonamide?
The IUPAC name of N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-pyrazole-5-sulfonamide (CID 102692323) is N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-pyrazole-5-sulfonamide.
What is the SMILES notation for N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-pyrazole-5-sulfonamide?
The canonical SMILES for N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-pyrazole-5-sulfonamide is Cn1cnnc1CNS(=O)(=O)c1ccn[nH]1.
What is the InChIKey of N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-pyrazole-5-sulfonamide?
The InChIKey is PYONKCLTCPNAHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N6O2S/c1-13-5-9-11-6(13)4-10-16(14,15)7-2-3-8-12-7/h2-3,5,10H,4H2,1H3,(H,8,12).
What are the key properties of N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-pyrazole-5-sulfonamide?
N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-pyrazole-5-sulfonamide has a molecular weight of 242.26 g/mol, XLogP of -0.98, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-pyrazole-5-sulfonamide is sourced from PubChem (CID 102692323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).