About N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-5-sulfonamide
N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-5-sulfonamide (PubChem CID 102692565) has the molecular formula C12H12FN3O2S2
and a molecular weight of 313.38 g/mol. Its IUPAC name is N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-5-sulfonamide |
| PubChem CID | 102692565 |
| Molecular Formula | C12H12FN3O2S2 |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-5-sulfonamide |
| SMILES | O=S(=O)(NC1CCSc2ccc(F)cc21)c1ccn[nH]1 |
| InChI | InChI=1S/C12H12FN3O2S2/c13-8-1-2-11-9(7-8)10(4-6-19-11)16-20(17,18)12-3-5-14-15-12/h1-3,5,7,10,16H,4,6H2,(H,14,15) |
| InChIKey | BMQQJOKEERUJNY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-5-sulfonamide?
The IUPAC name of N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-5-sulfonamide (CID 102692565) is N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-5-sulfonamide.
What is the SMILES notation for N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-5-sulfonamide?
The canonical SMILES for N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-5-sulfonamide is O=S(=O)(NC1CCSc2ccc(F)cc21)c1ccn[nH]1.
What is the InChIKey of N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-5-sulfonamide?
The InChIKey is BMQQJOKEERUJNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FN3O2S2/c13-8-1-2-11-9(7-8)10(4-6-19-11)16-20(17,18)12-3-5-14-15-12/h1-3,5,7,10,16H,4,6H2,(H,14,15).
What are the key properties of N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-5-sulfonamide?
N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-5-sulfonamide has a molecular weight of 313.38 g/mol, XLogP of 2.06, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1H-pyrazole-5-sulfonamide is sourced from PubChem (CID 102692565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).