C7H10F3N3O2S — CID 102692869
N-ethyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102692869) has the molecular formula C7H10F3N3O2S and a molecular weight of 257.24 g/mol. Its IUPAC name is N-ethyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-ethyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102692869 |
| Molecular Formula | C7H10F3N3O2S |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | N-ethyl-N-(2,2,2-trifluoroethyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCN(CC(F)(F)F)S(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C7H10F3N3O2S/c1-2-13(5-7(8,9)10)16(14,15)6-3-4-11-12-6/h3-4H,2,5H2,1H3,(H,11,12) |
| InChIKey | YWWMIDIAEFVICZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |