C23H27NO2 — CID 10269289
5-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]pyridine-2-carboxylic acid (PubChem CID 10269289) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is 5-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 10269289 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 5-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]pyridine-2-carboxylic acid |
| SMILES | C=C(c1ccc(C(=O)O)nc1)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C23H27NO2/c1-14-11-18-19(23(5,6)10-9-22(18,3)4)12-17(14)15(2)16-7-8-20(21(25)26)24-13-16/h7-8,11-13H,2,9-10H2,1,3-6H3,(H,25,26) |
| InChIKey | RQPGUBUDXBDMEV-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |