C11H6Cl3F3O3 — CID 10269293
(2S,3R)-5,6,7-trichloro-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid (PubChem CID 10269293) has the molecular formula C11H6Cl3F3O3 and a molecular weight of 349.52 g/mol. Its IUPAC name is (2S,3R)-5,6,7-trichloro-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid.
| Compound Name | (2S,3R)-5,6,7-trichloro-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 10269293 |
| Molecular Formula | C11H6Cl3F3O3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 347.93 |
| IUPAC Name | (2S,3R)-5,6,7-trichloro-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1Cc2c(cc(Cl)c(Cl)c2Cl)O[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C11H6Cl3F3O3/c12-5-2-6-3(7(13)8(5)14)1-4(10(18)19)9(20-6)11(15,16)17/h2,4,9H,1H2,(H,18,19)/t4-,9+/m1/s1 |
| InChIKey | ZBMFGJUPACNCSD-MOFOKWOHSA-N |
| XLogP | 4.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|