About 1-(2,3-dihydro-1H-inden-4-yl)-1-ethyl-3-(3-ethylphenyl)-3-propan-2-ylguanidine
1-(2,3-dihydro-1H-inden-4-yl)-1-ethyl-3-(3-ethylphenyl)-3-propan-2-ylguanidine (PubChem CID 10269294) has the molecular formula C23H31N3
and a molecular weight of 349.52 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-4-yl)-1-ethyl-3-(3-ethylphenyl)-3-propan-2-ylguanidine.
Molecular Properties
| Compound Name | 1-(2,3-dihydro-1H-inden-4-yl)-1-ethyl-3-(3-ethylphenyl)-3-propan-2-ylguanidine |
| PubChem CID | 10269294 |
| Molecular Formula | C23H31N3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-4-yl)-1-ethyl-3-(3-ethylphenyl)-3-propan-2-ylguanidine |
| SMILES | [H]/N=C(/N(CC)c1cccc2c1CCC2)N(c1cccc(CC)c1)C(C)C |
| InChI | InChI=1S/C23H31N3/c1-5-18-10-7-13-20(16-18)26(17(3)4)23(24)25(6-2)22-15-9-12-19-11-8-14-21(19)22/h7,9-10,12-13,15-17,24H,5-6,8,11,14H2,1-4H3/b24-23- |
| InChIKey | LZWBSAASWUJIEE-VHXPQNKSSA-N |
| XLogP | 5.41 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,3-dihydro-1H-inden-4-yl)-1-ethyl-3-(3-ethylphenyl)-3-propan-2-ylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydro-1H-inden-4-yl)-1-ethyl-3-(3-ethylphenyl)-3-propan-2-ylguanidine?
The IUPAC name of 1-(2,3-dihydro-1H-inden-4-yl)-1-ethyl-3-(3-ethylphenyl)-3-propan-2-ylguanidine (CID 10269294) is 1-(2,3-dihydro-1H-inden-4-yl)-1-ethyl-3-(3-ethylphenyl)-3-propan-2-ylguanidine.
What is the SMILES notation for 1-(2,3-dihydro-1H-inden-4-yl)-1-ethyl-3-(3-ethylphenyl)-3-propan-2-ylguanidine?
The canonical SMILES for 1-(2,3-dihydro-1H-inden-4-yl)-1-ethyl-3-(3-ethylphenyl)-3-propan-2-ylguanidine is [H]/N=C(/N(CC)c1cccc2c1CCC2)N(c1cccc(CC)c1)C(C)C.
What is the InChIKey of 1-(2,3-dihydro-1H-inden-4-yl)-1-ethyl-3-(3-ethylphenyl)-3-propan-2-ylguanidine?
The InChIKey is LZWBSAASWUJIEE-VHXPQNKSSA-N. The full InChI is InChI=1S/C23H31N3/c1-5-18-10-7-13-20(16-18)26(17(3)4)23(24)25(6-2)22-15-9-12-19-11-8-14-21(19)22/h7,9-10,12-13,15-17,24H,5-6,8,11,14H2,1-4H3/b24-23-.
What are the key properties of 1-(2,3-dihydro-1H-inden-4-yl)-1-ethyl-3-(3-ethylphenyl)-3-propan-2-ylguanidine?
1-(2,3-dihydro-1H-inden-4-yl)-1-ethyl-3-(3-ethylphenyl)-3-propan-2-ylguanidine has a molecular weight of 349.52 g/mol, XLogP of 5.41, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydro-1H-inden-4-yl)-1-ethyl-3-(3-ethylphenyl)-3-propan-2-ylguanidine is sourced from PubChem (CID 10269294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).