About N-(4,4,4-trifluorobutyl)-1H-pyrazole-5-sulfonamide
N-(4,4,4-trifluorobutyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102693246) has the molecular formula C7H10F3N3O2S
and a molecular weight of 257.24 g/mol. Its IUPAC name is N-(4,4,4-trifluorobutyl)-1H-pyrazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-(4,4,4-trifluorobutyl)-1H-pyrazole-5-sulfonamide |
| PubChem CID | 102693246 |
| Molecular Formula | C7H10F3N3O2S |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | N-(4,4,4-trifluorobutyl)-1H-pyrazole-5-sulfonamide |
| SMILES | O=S(=O)(NCCCC(F)(F)F)c1ccn[nH]1 |
| InChI | InChI=1S/C7H10F3N3O2S/c8-7(9,10)3-1-4-12-16(14,15)6-2-5-11-13-6/h2,5,12H,1,3-4H2,(H,11,13) |
| InChIKey | BUZATNHEMRXPJQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4,4,4-trifluorobutyl)-1H-pyrazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4,4-trifluorobutyl)-1H-pyrazole-5-sulfonamide?
The IUPAC name of N-(4,4,4-trifluorobutyl)-1H-pyrazole-5-sulfonamide (CID 102693246) is N-(4,4,4-trifluorobutyl)-1H-pyrazole-5-sulfonamide.
What is the SMILES notation for N-(4,4,4-trifluorobutyl)-1H-pyrazole-5-sulfonamide?
The canonical SMILES for N-(4,4,4-trifluorobutyl)-1H-pyrazole-5-sulfonamide is O=S(=O)(NCCCC(F)(F)F)c1ccn[nH]1.
What is the InChIKey of N-(4,4,4-trifluorobutyl)-1H-pyrazole-5-sulfonamide?
The InChIKey is BUZATNHEMRXPJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F3N3O2S/c8-7(9,10)3-1-4-12-16(14,15)6-2-5-11-13-6/h2,5,12H,1,3-4H2,(H,11,13).
What are the key properties of N-(4,4,4-trifluorobutyl)-1H-pyrazole-5-sulfonamide?
N-(4,4,4-trifluorobutyl)-1H-pyrazole-5-sulfonamide has a molecular weight of 257.24 g/mol, XLogP of 1.03, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4,4-trifluorobutyl)-1H-pyrazole-5-sulfonamide is sourced from PubChem (CID 102693246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).