C6H9F2N3O2S — CID 102693410
N-(2,2-difluoroethyl)-N-methyl-1H-pyrazole-5-sulfonamide (PubChem CID 102693410) has the molecular formula C6H9F2N3O2S and a molecular weight of 225.22 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N-methyl-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(2,2-difluoroethyl)-N-methyl-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102693410 |
| Molecular Formula | C6H9F2N3O2S |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | N-(2,2-difluoroethyl)-N-methyl-1H-pyrazole-5-sulfonamide |
| SMILES | CN(CC(F)F)S(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C6H9F2N3O2S/c1-11(4-5(7)8)14(12,13)6-2-3-9-10-6/h2-3,5H,4H2,1H3,(H,9,10) |
| InChIKey | KHDSDTLGERPPJO-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |