About N-(3-methyl-1,2,4-oxadiazol-5-yl)-1H-pyrazole-5-sulfonamide
N-(3-methyl-1,2,4-oxadiazol-5-yl)-1H-pyrazole-5-sulfonamide (PubChem CID 102693425) has the molecular formula C6H7N5O3S
and a molecular weight of 229.22 g/mol. Its IUPAC name is N-(3-methyl-1,2,4-oxadiazol-5-yl)-1H-pyrazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-(3-methyl-1,2,4-oxadiazol-5-yl)-1H-pyrazole-5-sulfonamide |
| PubChem CID | 102693425 |
| Molecular Formula | C6H7N5O3S |
| Molecular Weight | 229.22 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | N-(3-methyl-1,2,4-oxadiazol-5-yl)-1H-pyrazole-5-sulfonamide |
| SMILES | Cc1noc(NS(=O)(=O)c2ccn[nH]2)n1 |
| InChI | InChI=1S/C6H7N5O3S/c1-4-8-6(14-10-4)11-15(12,13)5-2-3-7-9-5/h2-3H,1H3,(H,7,9)(H,8,10,11) |
| InChIKey | ISVNGHORZUVWEI-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.22 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3-methyl-1,2,4-oxadiazol-5-yl)-1H-pyrazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methyl-1,2,4-oxadiazol-5-yl)-1H-pyrazole-5-sulfonamide?
The IUPAC name of N-(3-methyl-1,2,4-oxadiazol-5-yl)-1H-pyrazole-5-sulfonamide (CID 102693425) is N-(3-methyl-1,2,4-oxadiazol-5-yl)-1H-pyrazole-5-sulfonamide.
What is the SMILES notation for N-(3-methyl-1,2,4-oxadiazol-5-yl)-1H-pyrazole-5-sulfonamide?
The canonical SMILES for N-(3-methyl-1,2,4-oxadiazol-5-yl)-1H-pyrazole-5-sulfonamide is Cc1noc(NS(=O)(=O)c2ccn[nH]2)n1.
What is the InChIKey of N-(3-methyl-1,2,4-oxadiazol-5-yl)-1H-pyrazole-5-sulfonamide?
The InChIKey is ISVNGHORZUVWEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5O3S/c1-4-8-6(14-10-4)11-15(12,13)5-2-3-7-9-5/h2-3H,1H3,(H,7,9)(H,8,10,11).
What are the key properties of N-(3-methyl-1,2,4-oxadiazol-5-yl)-1H-pyrazole-5-sulfonamide?
N-(3-methyl-1,2,4-oxadiazol-5-yl)-1H-pyrazole-5-sulfonamide has a molecular weight of 229.22 g/mol, XLogP of -0.10, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methyl-1,2,4-oxadiazol-5-yl)-1H-pyrazole-5-sulfonamide is sourced from PubChem (CID 102693425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).