C9H17N3O2S2 — CID 102693435
N-methyl-N-(4-methylsulfanylbutan-2-yl)-1H-pyrazole-5-sulfonamide (PubChem CID 102693435) has the molecular formula C9H17N3O2S2 and a molecular weight of 263.39 g/mol. Its IUPAC name is N-methyl-N-(4-methylsulfanylbutan-2-yl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-methyl-N-(4-methylsulfanylbutan-2-yl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102693435 |
| Molecular Formula | C9H17N3O2S2 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | N-methyl-N-(4-methylsulfanylbutan-2-yl)-1H-pyrazole-5-sulfonamide |
| SMILES | CSCCC(C)N(C)S(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C9H17N3O2S2/c1-8(5-7-15-3)12(2)16(13,14)9-4-6-10-11-9/h4,6,8H,5,7H2,1-3H3,(H,10,11) |
| InChIKey | YHMVLALUASOULL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |