About N-(3-amino-2,2-difluoropropyl)-1H-pyrazole-5-sulfonamide
N-(3-amino-2,2-difluoropropyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102693688) has the molecular formula C6H10F2N4O2S
and a molecular weight of 240.23 g/mol. Its IUPAC name is N-(3-amino-2,2-difluoropropyl)-1H-pyrazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-(3-amino-2,2-difluoropropyl)-1H-pyrazole-5-sulfonamide |
| PubChem CID | 102693688 |
| Molecular Formula | C6H10F2N4O2S |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | N-(3-amino-2,2-difluoropropyl)-1H-pyrazole-5-sulfonamide |
| SMILES | NCC(F)(F)CNS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C6H10F2N4O2S/c7-6(8,3-9)4-11-15(13,14)5-1-2-10-12-5/h1-2,11H,3-4,9H2,(H,10,12) |
| InChIKey | FXDXKZYUFFLTOL-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-amino-2,2-difluoropropyl)-1H-pyrazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-2,2-difluoropropyl)-1H-pyrazole-5-sulfonamide?
The IUPAC name of N-(3-amino-2,2-difluoropropyl)-1H-pyrazole-5-sulfonamide (CID 102693688) is N-(3-amino-2,2-difluoropropyl)-1H-pyrazole-5-sulfonamide.
What is the SMILES notation for N-(3-amino-2,2-difluoropropyl)-1H-pyrazole-5-sulfonamide?
The canonical SMILES for N-(3-amino-2,2-difluoropropyl)-1H-pyrazole-5-sulfonamide is NCC(F)(F)CNS(=O)(=O)c1ccn[nH]1.
What is the InChIKey of N-(3-amino-2,2-difluoropropyl)-1H-pyrazole-5-sulfonamide?
The InChIKey is FXDXKZYUFFLTOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F2N4O2S/c7-6(8,3-9)4-11-15(13,14)5-1-2-10-12-5/h1-2,11H,3-4,9H2,(H,10,12).
What are the key properties of N-(3-amino-2,2-difluoropropyl)-1H-pyrazole-5-sulfonamide?
N-(3-amino-2,2-difluoropropyl)-1H-pyrazole-5-sulfonamide has a molecular weight of 240.23 g/mol, XLogP of -0.72, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-2,2-difluoropropyl)-1H-pyrazole-5-sulfonamide is sourced from PubChem (CID 102693688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).