C10H20N4O2S — CID 102694110
N-(2-aminoethyl)-N-pentan-3-yl-1H-pyrazole-5-sulfonamide (PubChem CID 102694110) has the molecular formula C10H20N4O2S and a molecular weight of 260.36 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-pentan-3-yl-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(2-aminoethyl)-N-pentan-3-yl-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102694110 |
| Molecular Formula | C10H20N4O2S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N-(2-aminoethyl)-N-pentan-3-yl-1H-pyrazole-5-sulfonamide |
| SMILES | CCC(CC)N(CCN)S(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C10H20N4O2S/c1-3-9(4-2)14(8-6-11)17(15,16)10-5-7-12-13-10/h5,7,9H,3-4,6,8,11H2,1-2H3,(H,12,13) |
| InChIKey | PMBDFJLVFKVDLG-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |