C17H13FN6O2 — CID 10269418
2-amino-N-[(4-fluorophenyl)methyl]-6-(furan-2-yl)purine-9-carboxamide (PubChem CID 10269418) has the molecular formula C17H13FN6O2 and a molecular weight of 352.33 g/mol. Its IUPAC name is 2-amino-N-[(4-fluorophenyl)methyl]-6-(furan-2-yl)purine-9-carboxamide.
| Compound Name | 2-amino-N-[(4-fluorophenyl)methyl]-6-(furan-2-yl)purine-9-carboxamide |
|---|---|
| PubChem CID | 10269418 |
| Molecular Formula | C17H13FN6O2 |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-amino-N-[(4-fluorophenyl)methyl]-6-(furan-2-yl)purine-9-carboxamide |
| SMILES | Nc1nc(-c2ccco2)c2ncn(C(=O)NCc3ccc(F)cc3)c2n1 |
| InChI | InChI=1S/C17H13FN6O2/c18-11-5-3-10(4-6-11)8-20-17(25)24-9-21-14-13(12-2-1-7-26-12)22-16(19)23-15(14)24/h1-7,9H,8H2,(H,20,25)(H2,19,22,23) |
| InChIKey | MZESVGYCZMDKDP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 111.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |