C11H12N4O5S — CID 102694756
3-methoxy-4-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)benzoic acid (PubChem CID 102694756) has the molecular formula C11H12N4O5S and a molecular weight of 312.31 g/mol. Its IUPAC name is 3-methoxy-4-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)benzoic acid.
| Compound Name | 3-methoxy-4-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 102694756 |
| Molecular Formula | C11H12N4O5S |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 3-methoxy-4-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)benzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1S(=O)(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C11H12N4O5S/c1-20-8-4-7(11(16)17)2-3-9(8)21(18,19)14-5-10-12-6-13-15-10/h2-4,6,14H,5H2,1H3,(H,16,17)(H,12,13,15) |
| InChIKey | OJYABALIWKGIGK-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |