C13H19NO5S — CID 102695591
3-[4-(2-methoxypropylsulfamoyl)phenyl]propanoic acid (PubChem CID 102695591) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is 3-[4-(2-methoxypropylsulfamoyl)phenyl]propanoic acid.
| Compound Name | 3-[4-(2-methoxypropylsulfamoyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 102695591 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 3-[4-(2-methoxypropylsulfamoyl)phenyl]propanoic acid |
| SMILES | COC(C)CNS(=O)(=O)c1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C13H19NO5S/c1-10(19-2)9-14-20(17,18)12-6-3-11(4-7-12)5-8-13(15)16/h3-4,6-7,10,14H,5,8-9H2,1-2H3,(H,15,16) |
| InChIKey | YVBLOIJCNTVWOC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |