C13H16F3NO3S2 — CID 10269592
(3R,5S)-1-methylsulfonyl-5-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-3-thiol (PubChem CID 10269592) has the molecular formula C13H16F3NO3S2 and a molecular weight of 355.40 g/mol. Its IUPAC name is (3R,5S)-1-methylsulfonyl-5-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-3-thiol.
| Compound Name | (3R,5S)-1-methylsulfonyl-5-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-3-thiol |
|---|---|
| PubChem CID | 10269592 |
| Molecular Formula | C13H16F3NO3S2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | (3R,5S)-1-methylsulfonyl-5-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-3-thiol |
| SMILES | CS(=O)(=O)N1C[C@H](S)C[C@H]1COCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C13H16F3NO3S2/c1-22(18,19)17-5-10(21)3-9(17)7-20-6-8-2-12(15)13(16)4-11(8)14/h2,4,9-10,21H,3,5-7H2,1H3/t9-,10+/m0/s1 |
| InChIKey | HNLHOJXMHKCHJU-VHSXEESVSA-N |
| XLogP | 1.95 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|