C16H22N2O2 — CID 102696219
6-methoxy-2-(3-propylpiperidin-3-yl)-1,3-benzoxazole (PubChem CID 102696219) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 6-methoxy-2-(3-propylpiperidin-3-yl)-1,3-benzoxazole.
| Compound Name | 6-methoxy-2-(3-propylpiperidin-3-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 102696219 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 6-methoxy-2-(3-propylpiperidin-3-yl)-1,3-benzoxazole |
| SMILES | CCCC1(c2nc3ccc(OC)cc3o2)CCCNC1 |
| InChI | InChI=1S/C16H22N2O2/c1-3-7-16(8-4-9-17-11-16)15-18-13-6-5-12(19-2)10-14(13)20-15/h5-6,10,17H,3-4,7-9,11H2,1-2H3 |
| InChIKey | GVOVTZLVFLXDEI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |