About 3-chloro-6-(4-propan-2-ylpiperazin-1-yl)benzo[b][1,4]benzoxazepine
3-chloro-6-(4-propan-2-ylpiperazin-1-yl)benzo[b][1,4]benzoxazepine (PubChem CID 10269628) has the molecular formula C20H22ClN3O
and a molecular weight of 355.87 g/mol. Its IUPAC name is 3-chloro-6-(4-propan-2-ylpiperazin-1-yl)benzo[b][1,4]benzoxazepine.
Molecular Properties
| Compound Name | 3-chloro-6-(4-propan-2-ylpiperazin-1-yl)benzo[b][1,4]benzoxazepine |
| PubChem CID | 10269628 |
| Molecular Formula | C20H22ClN3O |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 3-chloro-6-(4-propan-2-ylpiperazin-1-yl)benzo[b][1,4]benzoxazepine |
| SMILES | CC(C)N1CCN(C2=Nc3cc(Cl)ccc3Oc3ccccc32)CC1 |
| InChI | InChI=1S/C20H22ClN3O/c1-14(2)23-9-11-24(12-10-23)20-16-5-3-4-6-18(16)25-19-8-7-15(21)13-17(19)22-20/h3-8,13-14H,9-12H2,1-2H3 |
| InChIKey | HMRCFUPGLARKML-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-6-(4-propan-2-ylpiperazin-1-yl)benzo[b][1,4]benzoxazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-6-(4-propan-2-ylpiperazin-1-yl)benzo[b][1,4]benzoxazepine?
The IUPAC name of 3-chloro-6-(4-propan-2-ylpiperazin-1-yl)benzo[b][1,4]benzoxazepine (CID 10269628) is 3-chloro-6-(4-propan-2-ylpiperazin-1-yl)benzo[b][1,4]benzoxazepine.
What is the SMILES notation for 3-chloro-6-(4-propan-2-ylpiperazin-1-yl)benzo[b][1,4]benzoxazepine?
The canonical SMILES for 3-chloro-6-(4-propan-2-ylpiperazin-1-yl)benzo[b][1,4]benzoxazepine is CC(C)N1CCN(C2=Nc3cc(Cl)ccc3Oc3ccccc32)CC1.
What is the InChIKey of 3-chloro-6-(4-propan-2-ylpiperazin-1-yl)benzo[b][1,4]benzoxazepine?
The InChIKey is HMRCFUPGLARKML-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22ClN3O/c1-14(2)23-9-11-24(12-10-23)20-16-5-3-4-6-18(16)25-19-8-7-15(21)13-17(19)22-20/h3-8,13-14H,9-12H2,1-2H3.
What are the key properties of 3-chloro-6-(4-propan-2-ylpiperazin-1-yl)benzo[b][1,4]benzoxazepine?
3-chloro-6-(4-propan-2-ylpiperazin-1-yl)benzo[b][1,4]benzoxazepine has a molecular weight of 355.87 g/mol, XLogP of 4.55, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-6-(4-propan-2-ylpiperazin-1-yl)benzo[b][1,4]benzoxazepine is sourced from PubChem (CID 10269628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).