C24H20O3 — CID 10269652
(3'Z)-3'-[(4-hydroxyphenyl)methylidene]spiro[1,3-dihydroindene-2,2'-1H-indene]-5,5'-diol (PubChem CID 10269652) has the molecular formula C24H20O3 and a molecular weight of 356.42 g/mol. Its IUPAC name is (3'Z)-3'-[(4-hydroxyphenyl)methylidene]spiro[1,3-dihydroindene-2,2'-1H-indene]-5,5'-diol.
| Compound Name | (3'Z)-3'-[(4-hydroxyphenyl)methylidene]spiro[1,3-dihydroindene-2,2'-1H-indene]-5,5'-diol |
|---|---|
| PubChem CID | 10269652 |
| Molecular Formula | C24H20O3 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (3'Z)-3'-[(4-hydroxyphenyl)methylidene]spiro[1,3-dihydroindene-2,2'-1H-indene]-5,5'-diol |
| SMILES | Oc1ccc(/C=C2\c3cc(O)ccc3CC23Cc2ccc(O)cc2C3)cc1 |
| InChI | InChI=1S/C24H20O3/c25-19-5-1-15(2-6-19)9-23-22-11-21(27)8-4-17(22)13-24(23)12-16-3-7-20(26)10-18(16)14-24/h1-11,25-27H,12-14H2/b23-9+ |
| InChIKey | KAWLHRDKZZZJNQ-NUGSKGIGSA-N |
| XLogP | 4.69 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|