C10H22N2O2 — CID 102697212
N-(2-methoxypropyl)-1-(oxolan-2-yl)ethane-1,2-diamine (PubChem CID 102697212) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N-(2-methoxypropyl)-1-(oxolan-2-yl)ethane-1,2-diamine.
| Compound Name | N-(2-methoxypropyl)-1-(oxolan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 102697212 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | N-(2-methoxypropyl)-1-(oxolan-2-yl)ethane-1,2-diamine |
| SMILES | COC(C)CNC(CN)C1CCCO1 |
| InChI | InChI=1S/C10H22N2O2/c1-8(13-2)7-12-9(6-11)10-4-3-5-14-10/h8-10,12H,3-7,11H2,1-2H3 |
| InChIKey | UTOYXWOKPWIQBE-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |