C9H14N4OS — CID 102698302
5-(2-methoxypropylamino)pyrazine-2-carbothioamide (PubChem CID 102698302) has the molecular formula C9H14N4OS and a molecular weight of 226.31 g/mol. Its IUPAC name is 5-(2-methoxypropylamino)pyrazine-2-carbothioamide.
| Compound Name | 5-(2-methoxypropylamino)pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 102698302 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.31 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 5-(2-methoxypropylamino)pyrazine-2-carbothioamide |
| SMILES | COC(C)CNc1cnc(C(N)=S)cn1 |
| InChI | InChI=1S/C9H14N4OS/c1-6(14-2)3-12-8-5-11-7(4-13-8)9(10)15/h4-6H,3H2,1-2H3,(H2,10,15)(H,12,13) |
| InChIKey | QQIVRMWKIABWJC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|