C21H26FNO3 — CID 10269838
2-[1-(3-fluoro-5-propan-2-yloxyphenyl)ethoxy]-3-phenylmorpholine (PubChem CID 10269838) has the molecular formula C21H26FNO3 and a molecular weight of 359.44 g/mol. Its IUPAC name is 2-[1-(3-fluoro-5-propan-2-yloxyphenyl)ethoxy]-3-phenylmorpholine.
| Compound Name | 2-[1-(3-fluoro-5-propan-2-yloxyphenyl)ethoxy]-3-phenylmorpholine |
|---|---|
| PubChem CID | 10269838 |
| Molecular Formula | C21H26FNO3 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 2-[1-(3-fluoro-5-propan-2-yloxyphenyl)ethoxy]-3-phenylmorpholine |
| SMILES | CC(C)Oc1cc(F)cc(C(C)OC2OCCNC2c2ccccc2)c1 |
| InChI | InChI=1S/C21H26FNO3/c1-14(2)25-19-12-17(11-18(22)13-19)15(3)26-21-20(23-9-10-24-21)16-7-5-4-6-8-16/h4-8,11-15,20-21,23H,9-10H2,1-3H3 |
| InChIKey | FCXDRRVJPDYPGR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |