C16H10ClN3O3S — CID 10269854
7-chloro-2-(thiophen-2-ylmethyl)-3,5-dihydropyridazino[4,5-b]quinoline-1,4,10-trione (PubChem CID 10269854) has the molecular formula C16H10ClN3O3S and a molecular weight of 359.79 g/mol. Its IUPAC name is 7-chloro-2-(thiophen-2-ylmethyl)-3,5-dihydropyridazino[4,5-b]quinoline-1,4,10-trione.
| Compound Name | 7-chloro-2-(thiophen-2-ylmethyl)-3,5-dihydropyridazino[4,5-b]quinoline-1,4,10-trione |
|---|---|
| PubChem CID | 10269854 |
| Molecular Formula | C16H10ClN3O3S |
| Molecular Weight | 359.79 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 7-chloro-2-(thiophen-2-ylmethyl)-3,5-dihydropyridazino[4,5-b]quinoline-1,4,10-trione |
| SMILES | O=c1[nH]n(Cc2cccs2)c(=O)c2c(=O)c3ccc(Cl)cc3[nH]c12 |
| InChI | InChI=1S/C16H10ClN3O3S/c17-8-3-4-10-11(6-8)18-13-12(14(10)21)16(23)20(19-15(13)22)7-9-2-1-5-24-9/h1-6H,7H2,(H,18,21)(H,19,22) |
| InChIKey | KMAKOKCMJADPKV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.79 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|