C9H16N4O — CID 102698905
N-(2-methoxypropyl)-5,6-dimethyl-1,2,4-triazin-3-amine (PubChem CID 102698905) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is N-(2-methoxypropyl)-5,6-dimethyl-1,2,4-triazin-3-amine.
| Compound Name | N-(2-methoxypropyl)-5,6-dimethyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 102698905 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | N-(2-methoxypropyl)-5,6-dimethyl-1,2,4-triazin-3-amine |
| SMILES | COC(C)CNc1nnc(C)c(C)n1 |
| InChI | InChI=1S/C9H16N4O/c1-6(14-4)5-10-9-11-7(2)8(3)12-13-9/h6H,5H2,1-4H3,(H,10,11,13) |
| InChIKey | ALBYCUGZIHRCAG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |