C13H28N2OS — CID 102700050
1-(2-methoxypropyl)-3-(2,4,4-trimethylpentan-2-yl)thiourea (PubChem CID 102700050) has the molecular formula C13H28N2OS and a molecular weight of 260.45 g/mol. Its IUPAC name is 1-(2-methoxypropyl)-3-(2,4,4-trimethylpentan-2-yl)thiourea.
| Compound Name | 1-(2-methoxypropyl)-3-(2,4,4-trimethylpentan-2-yl)thiourea |
|---|---|
| PubChem CID | 102700050 |
| Molecular Formula | C13H28N2OS |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 1-(2-methoxypropyl)-3-(2,4,4-trimethylpentan-2-yl)thiourea |
| SMILES | COC(C)CNC(=S)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C13H28N2OS/c1-10(16-7)8-14-11(17)15-13(5,6)9-12(2,3)4/h10H,8-9H2,1-7H3,(H2,14,15,17) |
| InChIKey | CHUWOCWEVCADIO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|