About 1-(2-methoxypropyl)-2,5-dimethylpyrrole
1-(2-methoxypropyl)-2,5-dimethylpyrrole (PubChem CID 102700135) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 1-(2-methoxypropyl)-2,5-dimethylpyrrole.
Molecular Properties
| Compound Name | 1-(2-methoxypropyl)-2,5-dimethylpyrrole |
| PubChem CID | 102700135 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1-(2-methoxypropyl)-2,5-dimethylpyrrole |
| SMILES | COC(C)Cn1c(C)ccc1C |
| InChI | InChI=1S/C10H17NO/c1-8-5-6-9(2)11(8)7-10(3)12-4/h5-6,10H,7H2,1-4H3 |
| InChIKey | MAQISKPIOOPJMQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-methoxypropyl)-2,5-dimethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxypropyl)-2,5-dimethylpyrrole?
The IUPAC name of 1-(2-methoxypropyl)-2,5-dimethylpyrrole (CID 102700135) is 1-(2-methoxypropyl)-2,5-dimethylpyrrole.
What is the SMILES notation for 1-(2-methoxypropyl)-2,5-dimethylpyrrole?
The canonical SMILES for 1-(2-methoxypropyl)-2,5-dimethylpyrrole is COC(C)Cn1c(C)ccc1C.
What is the InChIKey of 1-(2-methoxypropyl)-2,5-dimethylpyrrole?
The InChIKey is MAQISKPIOOPJMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-8-5-6-9(2)11(8)7-10(3)12-4/h5-6,10H,7H2,1-4H3.
What are the key properties of 1-(2-methoxypropyl)-2,5-dimethylpyrrole?
1-(2-methoxypropyl)-2,5-dimethylpyrrole has a molecular weight of 167.25 g/mol, XLogP of 2.14, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxypropyl)-2,5-dimethylpyrrole is sourced from PubChem (CID 102700135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).