C9H15N3O2 — CID 102700145
N-(2-methoxypropyl)-5-methyl-1H-pyrazole-4-carboxamide (PubChem CID 102700145) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is N-(2-methoxypropyl)-5-methyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-(2-methoxypropyl)-5-methyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 102700145 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N-(2-methoxypropyl)-5-methyl-1H-pyrazole-4-carboxamide |
| SMILES | COC(C)CNC(=O)c1cn[nH]c1C |
| InChI | InChI=1S/C9H15N3O2/c1-6(14-3)4-10-9(13)8-5-11-12-7(8)2/h5-6H,4H2,1-3H3,(H,10,13)(H,11,12) |
| InChIKey | BKGNWDIGELIUKD-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |