C10H16N2O2 — CID 102700306
[2-(2-methoxypropylamino)-4-pyridinyl]methanol (PubChem CID 102700306) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is [2-(2-methoxypropylamino)-4-pyridinyl]methanol.
| Compound Name | [2-(2-methoxypropylamino)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 102700306 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | [2-(2-methoxypropylamino)-4-pyridinyl]methanol |
| SMILES | COC(C)CNc1cc(CO)ccn1 |
| InChI | InChI=1S/C10H16N2O2/c1-8(14-2)6-12-10-5-9(7-13)3-4-11-10/h3-5,8,13H,6-7H2,1-2H3,(H,11,12) |
| InChIKey | LDFWPFRTHFAMLH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |