C11H14BrClFNO3S — CID 102701391
5-bromo-3-(chloromethyl)-2-fluoro-N-(2-methoxypropyl)benzenesulfonamide (PubChem CID 102701391) has the molecular formula C11H14BrClFNO3S and a molecular weight of 374.66 g/mol. Its IUPAC name is 5-bromo-3-(chloromethyl)-2-fluoro-N-(2-methoxypropyl)benzenesulfonamide.
| Compound Name | 5-bromo-3-(chloromethyl)-2-fluoro-N-(2-methoxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 102701391 |
| Molecular Formula | C11H14BrClFNO3S |
| Molecular Weight | 374.66 g/mol |
| Exact Mass | 372.96 |
| IUPAC Name | 5-bromo-3-(chloromethyl)-2-fluoro-N-(2-methoxypropyl)benzenesulfonamide |
| SMILES | COC(C)CNS(=O)(=O)c1cc(Br)cc(CCl)c1F |
| InChI | InChI=1S/C11H14BrClFNO3S/c1-7(18-2)6-15-19(16,17)10-4-9(12)3-8(5-13)11(10)14/h3-4,7,15H,5-6H2,1-2H3 |
| InChIKey | SWTDHCPJVDENFN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.66 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|