C10H19N3O — CID 102701714
N-[[3-(2-methoxypropyl)imidazol-4-yl]methyl]ethanamine (PubChem CID 102701714) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is N-[[3-(2-methoxypropyl)imidazol-4-yl]methyl]ethanamine.
| Compound Name | N-[[3-(2-methoxypropyl)imidazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 102701714 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | N-[[3-(2-methoxypropyl)imidazol-4-yl]methyl]ethanamine |
| SMILES | CCNCc1cncn1CC(C)OC |
| InChI | InChI=1S/C10H19N3O/c1-4-11-5-10-6-12-8-13(10)7-9(2)14-3/h6,8-9,11H,4-5,7H2,1-3H3 |
| InChIKey | XELWWOSBSCCXIT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |