C18H30N4O4 — CID 10270281
5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-N-propyl-1,2,4-oxadiazole-3-carboxamide (PubChem CID 10270281) has the molecular formula C18H30N4O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is 5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-N-propyl-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-N-propyl-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 10270281 |
| Molecular Formula | C18H30N4O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 5-[(3R)-6-cyclohexyl-1-(hydroxyamino)-1-oxohexan-3-yl]-N-propyl-1,2,4-oxadiazole-3-carboxamide |
| SMILES | CCCNC(=O)c1noc(C(CCCC2CCCCC2)CC(=O)NO)n1 |
| InChI | InChI=1S/C18H30N4O4/c1-2-11-19-17(24)16-20-18(26-22-16)14(12-15(23)21-25)10-6-9-13-7-4-3-5-8-13/h13-14,25H,2-12H2,1H3,(H,19,24)(H,21,23) |
| InChIKey | IALSBWBRIDYNGC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|