About N-[6-(2-chlorophenyl)-3,4-dimethyl-2-pyridinyl]-5-fluoro-1H-indazol-3-amine
N-[6-(2-chlorophenyl)-3,4-dimethyl-2-pyridinyl]-5-fluoro-1H-indazol-3-amine (PubChem CID 10270291) has the molecular formula C20H16ClFN4
and a molecular weight of 366.83 g/mol. Its IUPAC name is N-[6-(2-chlorophenyl)-3,4-dimethyl-2-pyridinyl]-5-fluoro-1H-indazol-3-amine.
Molecular Properties
| Compound Name | N-[6-(2-chlorophenyl)-3,4-dimethyl-2-pyridinyl]-5-fluoro-1H-indazol-3-amine |
| PubChem CID | 10270291 |
| Molecular Formula | C20H16ClFN4 |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-[6-(2-chlorophenyl)-3,4-dimethyl-2-pyridinyl]-5-fluoro-1H-indazol-3-amine |
| SMILES | Cc1cc(-c2ccccc2Cl)nc(Nc2n[nH]c3ccc(F)cc23)c1C |
| InChI | InChI=1S/C20H16ClFN4/c1-11-9-18(14-5-3-4-6-16(14)21)23-19(12(11)2)24-20-15-10-13(22)7-8-17(15)25-26-20/h3-10H,1-2H3,(H2,23,24,25,26) |
| InChIKey | JRVNKHUIGUKFFU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[6-(2-chlorophenyl)-3,4-dimethyl-2-pyridinyl]-5-fluoro-1H-indazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(2-chlorophenyl)-3,4-dimethyl-2-pyridinyl]-5-fluoro-1H-indazol-3-amine?
The IUPAC name of N-[6-(2-chlorophenyl)-3,4-dimethyl-2-pyridinyl]-5-fluoro-1H-indazol-3-amine (CID 10270291) is N-[6-(2-chlorophenyl)-3,4-dimethyl-2-pyridinyl]-5-fluoro-1H-indazol-3-amine.
What is the SMILES notation for N-[6-(2-chlorophenyl)-3,4-dimethyl-2-pyridinyl]-5-fluoro-1H-indazol-3-amine?
The canonical SMILES for N-[6-(2-chlorophenyl)-3,4-dimethyl-2-pyridinyl]-5-fluoro-1H-indazol-3-amine is Cc1cc(-c2ccccc2Cl)nc(Nc2n[nH]c3ccc(F)cc23)c1C.
What is the InChIKey of N-[6-(2-chlorophenyl)-3,4-dimethyl-2-pyridinyl]-5-fluoro-1H-indazol-3-amine?
The InChIKey is JRVNKHUIGUKFFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClFN4/c1-11-9-18(14-5-3-4-6-16(14)21)23-19(12(11)2)24-20-15-10-13(22)7-8-17(15)25-26-20/h3-10H,1-2H3,(H2,23,24,25,26).
What are the key properties of N-[6-(2-chlorophenyl)-3,4-dimethyl-2-pyridinyl]-5-fluoro-1H-indazol-3-amine?
N-[6-(2-chlorophenyl)-3,4-dimethyl-2-pyridinyl]-5-fluoro-1H-indazol-3-amine has a molecular weight of 366.83 g/mol, XLogP of 5.78, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(2-chlorophenyl)-3,4-dimethyl-2-pyridinyl]-5-fluoro-1H-indazol-3-amine is sourced from PubChem (CID 10270291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).