C17H16Cl2N2OS — CID 10270299
(E)-3-cyclopentyl-2-(3,4-dichlorophenyl)-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 10270299) has the molecular formula C17H16Cl2N2OS and a molecular weight of 367.30 g/mol. Its IUPAC name is (E)-3-cyclopentyl-2-(3,4-dichlorophenyl)-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-cyclopentyl-2-(3,4-dichlorophenyl)-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 10270299 |
| Molecular Formula | C17H16Cl2N2OS |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | (E)-3-cyclopentyl-2-(3,4-dichlorophenyl)-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | O=C(Nc1nccs1)/C(=C/C1CCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N2OS/c18-14-6-5-12(10-15(14)19)13(9-11-3-1-2-4-11)16(22)21-17-20-7-8-23-17/h5-11H,1-4H2,(H,20,21,22)/b13-9+ |
| InChIKey | LPANTTLHGJJATA-UKTHLTGXSA-N |
| XLogP | 5.66 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|