C12H13N5O2 — CID 102703255
N-(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)pyridine-4-carboxamide (PubChem CID 102703255) has the molecular formula C12H13N5O2 and a molecular weight of 259.27 g/mol. Its IUPAC name is N-(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)pyridine-4-carboxamide.
| Compound Name | N-(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 102703255 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | N-(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1nnc(C2CCCN2)o1)c1ccncc1 |
| InChI | InChI=1S/C12H13N5O2/c18-10(8-3-6-13-7-4-8)15-12-17-16-11(19-12)9-2-1-5-14-9/h3-4,6-7,9,14H,1-2,5H2,(H,15,17,18) |
| InChIKey | PDPPOBPJEGSGTR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |