C9H15N5O2 — CID 102703600
1-ethyl-3-(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)urea (PubChem CID 102703600) has the molecular formula C9H15N5O2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 1-ethyl-3-(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)urea.
| Compound Name | 1-ethyl-3-(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)urea |
|---|---|
| PubChem CID | 102703600 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 1-ethyl-3-(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)urea |
| SMILES | CCNC(=O)Nc1nnc(C2CCCN2)o1 |
| InChI | InChI=1S/C9H15N5O2/c1-2-10-8(15)12-9-14-13-7(16-9)6-4-3-5-11-6/h6,11H,2-5H2,1H3,(H2,10,12,14,15) |
| InChIKey | BLYDRRCUKQQOLN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |