About methyl 3-[(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)sulfamoyl]propanoate
methyl 3-[(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)sulfamoyl]propanoate (PubChem CID 102703727) has the molecular formula C10H16N4O5S
and a molecular weight of 304.33 g/mol. Its IUPAC name is methyl 3-[(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)sulfamoyl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)sulfamoyl]propanoate |
| PubChem CID | 102703727 |
| Molecular Formula | C10H16N4O5S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | methyl 3-[(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)sulfamoyl]propanoate |
| SMILES | COC(=O)CCS(=O)(=O)Nc1nnc(C2CCCN2)o1 |
| InChI | InChI=1S/C10H16N4O5S/c1-18-8(15)4-6-20(16,17)14-10-13-12-9(19-10)7-3-2-5-11-7/h7,11H,2-6H2,1H3,(H,13,14) |
| InChIKey | SOBJQUZOSXSVIP-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 3-[(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)sulfamoyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)sulfamoyl]propanoate?
The IUPAC name of methyl 3-[(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)sulfamoyl]propanoate (CID 102703727) is methyl 3-[(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)sulfamoyl]propanoate.
What is the SMILES notation for methyl 3-[(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)sulfamoyl]propanoate?
The canonical SMILES for methyl 3-[(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)sulfamoyl]propanoate is COC(=O)CCS(=O)(=O)Nc1nnc(C2CCCN2)o1.
What is the InChIKey of methyl 3-[(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)sulfamoyl]propanoate?
The InChIKey is SOBJQUZOSXSVIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O5S/c1-18-8(15)4-6-20(16,17)14-10-13-12-9(19-10)7-3-2-5-11-7/h7,11H,2-6H2,1H3,(H,13,14).
What are the key properties of methyl 3-[(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)sulfamoyl]propanoate?
methyl 3-[(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)sulfamoyl]propanoate has a molecular weight of 304.33 g/mol, XLogP of -0.20, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(5-pyrrolidin-2-yl-1,3,4-oxadiazol-2-yl)sulfamoyl]propanoate is sourced from PubChem (CID 102703727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).