C16H24N2O2 — CID 102706208
3-pyrrolidin-1-ylpropyl 5-amino-2,4-dimethylbenzoate (PubChem CID 102706208) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-pyrrolidin-1-ylpropyl 5-amino-2,4-dimethylbenzoate.
| Compound Name | 3-pyrrolidin-1-ylpropyl 5-amino-2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 102706208 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 3-pyrrolidin-1-ylpropyl 5-amino-2,4-dimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OCCCN2CCCC2)cc1N |
| InChI | InChI=1S/C16H24N2O2/c1-12-10-13(2)15(17)11-14(12)16(19)20-9-5-8-18-6-3-4-7-18/h10-11H,3-9,17H2,1-2H3 |
| InChIKey | HBFFYWPUSOXXLK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|