C15H14FN5 — CID 102706309
5-[1-(2-fluorophenyl)tetrazol-5-yl]-2,4-dimethylaniline (PubChem CID 102706309) has the molecular formula C15H14FN5 and a molecular weight of 283.31 g/mol. Its IUPAC name is 5-[1-(2-fluorophenyl)tetrazol-5-yl]-2,4-dimethylaniline.
| Compound Name | 5-[1-(2-fluorophenyl)tetrazol-5-yl]-2,4-dimethylaniline |
|---|---|
| PubChem CID | 102706309 |
| Molecular Formula | C15H14FN5 |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 5-[1-(2-fluorophenyl)tetrazol-5-yl]-2,4-dimethylaniline |
| SMILES | Cc1cc(C)c(-c2nnnn2-c2ccccc2F)cc1N |
| InChI | InChI=1S/C15H14FN5/c1-9-7-10(2)13(17)8-11(9)15-18-19-20-21(15)14-6-4-3-5-12(14)16/h3-8H,17H2,1-2H3 |
| InChIKey | CTFZGMSLHSDMAB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|