About 5-[1-(1-cyclobutylethyl)tetrazol-5-yl]-2,4-dimethylaniline
5-[1-(1-cyclobutylethyl)tetrazol-5-yl]-2,4-dimethylaniline (PubChem CID 102706416) has the molecular formula C15H21N5
and a molecular weight of 271.37 g/mol. Its IUPAC name is 5-[1-(1-cyclobutylethyl)tetrazol-5-yl]-2,4-dimethylaniline.
Molecular Properties
| Compound Name | 5-[1-(1-cyclobutylethyl)tetrazol-5-yl]-2,4-dimethylaniline |
| PubChem CID | 102706416 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 5-[1-(1-cyclobutylethyl)tetrazol-5-yl]-2,4-dimethylaniline |
| SMILES | Cc1cc(C)c(-c2nnnn2C(C)C2CCC2)cc1N |
| InChI | InChI=1S/C15H21N5/c1-9-7-10(2)14(16)8-13(9)15-17-18-19-20(15)11(3)12-5-4-6-12/h7-8,11-12H,4-6,16H2,1-3H3 |
| InChIKey | GPMIZBWPIGFPDF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-(1-cyclobutylethyl)tetrazol-5-yl]-2,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(1-cyclobutylethyl)tetrazol-5-yl]-2,4-dimethylaniline?
The IUPAC name of 5-[1-(1-cyclobutylethyl)tetrazol-5-yl]-2,4-dimethylaniline (CID 102706416) is 5-[1-(1-cyclobutylethyl)tetrazol-5-yl]-2,4-dimethylaniline.
What is the SMILES notation for 5-[1-(1-cyclobutylethyl)tetrazol-5-yl]-2,4-dimethylaniline?
The canonical SMILES for 5-[1-(1-cyclobutylethyl)tetrazol-5-yl]-2,4-dimethylaniline is Cc1cc(C)c(-c2nnnn2C(C)C2CCC2)cc1N.
What is the InChIKey of 5-[1-(1-cyclobutylethyl)tetrazol-5-yl]-2,4-dimethylaniline?
The InChIKey is GPMIZBWPIGFPDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N5/c1-9-7-10(2)14(16)8-13(9)15-17-18-19-20(15)11(3)12-5-4-6-12/h7-8,11-12H,4-6,16H2,1-3H3.
What are the key properties of 5-[1-(1-cyclobutylethyl)tetrazol-5-yl]-2,4-dimethylaniline?
5-[1-(1-cyclobutylethyl)tetrazol-5-yl]-2,4-dimethylaniline has a molecular weight of 271.37 g/mol, XLogP of 2.90, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(1-cyclobutylethyl)tetrazol-5-yl]-2,4-dimethylaniline is sourced from PubChem (CID 102706416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).