C17H32N2O2 — CID 102706761
5-amino-N-(2-cyclohexyloxyethyl)-2,4-dimethylcyclohexane-1-carboxamide (PubChem CID 102706761) has the molecular formula C17H32N2O2 and a molecular weight of 296.45 g/mol. Its IUPAC name is 5-amino-N-(2-cyclohexyloxyethyl)-2,4-dimethylcyclohexane-1-carboxamide.
| Compound Name | 5-amino-N-(2-cyclohexyloxyethyl)-2,4-dimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 102706761 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 5-amino-N-(2-cyclohexyloxyethyl)-2,4-dimethylcyclohexane-1-carboxamide |
| SMILES | CC1CC(C)C(C(=O)NCCOC2CCCCC2)CC1N |
| InChI | InChI=1S/C17H32N2O2/c1-12-10-13(2)16(18)11-15(12)17(20)19-8-9-21-14-6-4-3-5-7-14/h12-16H,3-11,18H2,1-2H3,(H,19,20) |
| InChIKey | MDRLEVRVQIRPRW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|