About N-[2-[4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]propyl]propane-2-sulfonamide
N-[2-[4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]propyl]propane-2-sulfonamide (PubChem CID 10270702) has the molecular formula C19H23N3O3S
and a molecular weight of 373.48 g/mol. Its IUPAC name is N-[2-[4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]propyl]propane-2-sulfonamide.
Molecular Properties
| Compound Name | N-[2-[4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]propyl]propane-2-sulfonamide |
| PubChem CID | 10270702 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-[2-[4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]propyl]propane-2-sulfonamide |
| SMILES | CC(CNS(=O)(=O)C(C)C)c1ccc(-c2ccc3[nH]c(=O)[nH]c3c2)cc1 |
| InChI | InChI=1S/C19H23N3O3S/c1-12(2)26(24,25)20-11-13(3)14-4-6-15(7-5-14)16-8-9-17-18(10-16)22-19(23)21-17/h4-10,12-13,20H,11H2,1-3H3,(H2,21,22,23) |
| InChIKey | XALDNIAGCFDKRF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-[4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]propyl]propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]propyl]propane-2-sulfonamide?
The IUPAC name of N-[2-[4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]propyl]propane-2-sulfonamide (CID 10270702) is N-[2-[4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]propyl]propane-2-sulfonamide.
What is the SMILES notation for N-[2-[4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]propyl]propane-2-sulfonamide?
The canonical SMILES for N-[2-[4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]propyl]propane-2-sulfonamide is CC(CNS(=O)(=O)C(C)C)c1ccc(-c2ccc3[nH]c(=O)[nH]c3c2)cc1.
What is the InChIKey of N-[2-[4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]propyl]propane-2-sulfonamide?
The InChIKey is XALDNIAGCFDKRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O3S/c1-12(2)26(24,25)20-11-13(3)14-4-6-15(7-5-14)16-8-9-17-18(10-16)22-19(23)21-17/h4-10,12-13,20H,11H2,1-3H3,(H2,21,22,23).
What are the key properties of N-[2-[4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]propyl]propane-2-sulfonamide?
N-[2-[4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]propyl]propane-2-sulfonamide has a molecular weight of 373.48 g/mol, XLogP of 2.95, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)phenyl]propyl]propane-2-sulfonamide is sourced from PubChem (CID 10270702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).