C13H13F6NO — CID 102707349
4-(trifluoromethyl)-1-[4-(trifluoromethyl)-3-pyridinyl]cyclohexan-1-ol (PubChem CID 102707349) has the molecular formula C13H13F6NO and a molecular weight of 313.24 g/mol. Its IUPAC name is 4-(trifluoromethyl)-1-[4-(trifluoromethyl)-3-pyridinyl]cyclohexan-1-ol.
| Compound Name | 4-(trifluoromethyl)-1-[4-(trifluoromethyl)-3-pyridinyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 102707349 |
| Molecular Formula | C13H13F6NO |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 4-(trifluoromethyl)-1-[4-(trifluoromethyl)-3-pyridinyl]cyclohexan-1-ol |
| SMILES | OC1(c2cnccc2C(F)(F)F)CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H13F6NO/c14-12(15,16)8-1-4-11(21,5-2-8)10-7-20-6-3-9(10)13(17,18)19/h3,6-8,21H,1-2,4-5H2 |
| InChIKey | DLAMWZAXUNOWPQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |