C18H22N4O3S — CID 10270770
3-(carbamoylamino)-5-[4-(2-pyrrolidin-1-ylethoxy)phenyl]thiophene-2-carboxamide (PubChem CID 10270770) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is 3-(carbamoylamino)-5-[4-(2-pyrrolidin-1-ylethoxy)phenyl]thiophene-2-carboxamide.
| Compound Name | 3-(carbamoylamino)-5-[4-(2-pyrrolidin-1-ylethoxy)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 10270770 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 3-(carbamoylamino)-5-[4-(2-pyrrolidin-1-ylethoxy)phenyl]thiophene-2-carboxamide |
| SMILES | NC(=O)Nc1cc(-c2ccc(OCCN3CCCC3)cc2)sc1C(N)=O |
| InChI | InChI=1S/C18H22N4O3S/c19-17(23)16-14(21-18(20)24)11-15(26-16)12-3-5-13(6-4-12)25-10-9-22-7-1-2-8-22/h3-6,11H,1-2,7-10H2,(H2,19,23)(H3,20,21,24) |
| InChIKey | ZDQLZTAJWGOWEF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |