C14H13F3N2 — CID 102708695
[3-methyl-4-[4-(trifluoromethyl)-3-pyridinyl]phenyl]methanamine (PubChem CID 102708695) has the molecular formula C14H13F3N2 and a molecular weight of 266.27 g/mol. Its IUPAC name is [3-methyl-4-[4-(trifluoromethyl)-3-pyridinyl]phenyl]methanamine.
| Compound Name | [3-methyl-4-[4-(trifluoromethyl)-3-pyridinyl]phenyl]methanamine |
|---|---|
| PubChem CID | 102708695 |
| Molecular Formula | C14H13F3N2 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | [3-methyl-4-[4-(trifluoromethyl)-3-pyridinyl]phenyl]methanamine |
| SMILES | Cc1cc(CN)ccc1-c1cnccc1C(F)(F)F |
| InChI | InChI=1S/C14H13F3N2/c1-9-6-10(7-18)2-3-11(9)12-8-19-5-4-13(12)14(15,16)17/h2-6,8H,7,18H2,1H3 |
| InChIKey | OTDZIEUOGNCMSA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |