C13H19F3N2 — CID 102708886
N-propyl-4-[4-(trifluoromethyl)-3-pyridinyl]butan-2-amine (PubChem CID 102708886) has the molecular formula C13H19F3N2 and a molecular weight of 260.30 g/mol. Its IUPAC name is N-propyl-4-[4-(trifluoromethyl)-3-pyridinyl]butan-2-amine.
| Compound Name | N-propyl-4-[4-(trifluoromethyl)-3-pyridinyl]butan-2-amine |
|---|---|
| PubChem CID | 102708886 |
| Molecular Formula | C13H19F3N2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-propyl-4-[4-(trifluoromethyl)-3-pyridinyl]butan-2-amine |
| SMILES | CCCNC(C)CCc1cnccc1C(F)(F)F |
| InChI | InChI=1S/C13H19F3N2/c1-3-7-18-10(2)4-5-11-9-17-8-6-12(11)13(14,15)16/h6,8-10,18H,3-5,7H2,1-2H3 |
| InChIKey | WPSGQIXPHSWHLS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |